C10H20O5 — CID 91325280
3-prop-2-enoxyheptane-2,3,5,6-tetrol (PubChem CID 91325280) has the molecular formula C10H20O5 and a molecular weight of 220.26 g/mol. Its IUPAC name is 3-prop-2-enoxyheptane-2,3,5,6-tetrol.
| Compound Name | 3-prop-2-enoxyheptane-2,3,5,6-tetrol |
|---|---|
| PubChem CID | 91325280 |
| Molecular Formula | C10H20O5 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 3-prop-2-enoxyheptane-2,3,5,6-tetrol |
| SMILES | C=CCOC(O)(CC(O)C(C)O)C(C)O |
| InChI | InChI=1S/C10H20O5/c1-4-5-15-10(14,8(3)12)6-9(13)7(2)11/h4,7-9,11-14H,1,5-6H2,2-3H3 |
| InChIKey | OCNCABBVYSSMMZ-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|