C14H28O — CID 59926274
(3S,5R)-2,3,5,6-tetramethyl-3-prop-2-enoxyheptane (PubChem CID 59926274) has the molecular formula C14H28O and a molecular weight of 212.38 g/mol. Its IUPAC name is (3S,5R)-2,3,5,6-tetramethyl-3-prop-2-enoxyheptane.
| Compound Name | (3S,5R)-2,3,5,6-tetramethyl-3-prop-2-enoxyheptane |
|---|---|
| PubChem CID | 59926274 |
| Molecular Formula | C14H28O |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.21 |
| IUPAC Name | (3S,5R)-2,3,5,6-tetramethyl-3-prop-2-enoxyheptane |
| SMILES | C=CCO[C@@](C)(C[C@@H](C)C(C)C)C(C)C |
| InChI | InChI=1S/C14H28O/c1-8-9-15-14(7,12(4)5)10-13(6)11(2)3/h8,11-13H,1,9-10H2,2-7H3/t13-,14+/m1/s1 |
| InChIKey | YIRWTYQCSCGEHJ-KGLIPLIRSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|