C13H22O2 — CID 101079962
(4S,5R)-4-methyl-4-prop-2-enoxynona-1,8-dien-5-ol (PubChem CID 101079962) has the molecular formula C13H22O2 and a molecular weight of 210.32 g/mol. Its IUPAC name is (4S,5R)-4-methyl-4-prop-2-enoxynona-1,8-dien-5-ol.
| Compound Name | (4S,5R)-4-methyl-4-prop-2-enoxynona-1,8-dien-5-ol |
|---|---|
| PubChem CID | 101079962 |
| Molecular Formula | C13H22O2 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.16 |
| IUPAC Name | (4S,5R)-4-methyl-4-prop-2-enoxynona-1,8-dien-5-ol |
| SMILES | C=CCC[C@@H](O)[C@](C)(CC=C)OCC=C |
| InChI | InChI=1S/C13H22O2/c1-5-8-9-12(14)13(4,10-6-2)15-11-7-3/h5-7,12,14H,1-3,8-11H2,4H3/t12-,13+/m1/s1 |
| InChIKey | XYFUOLRNZVIRET-OLZOCXBDSA-N |
| XLogP | 2.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|