C16H26O2 — CID 10562662
(4R,5R)-4-methyl-4,5-bis(prop-2-enoxy)nona-1,8-diene (PubChem CID 10562662) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (4R,5R)-4-methyl-4,5-bis(prop-2-enoxy)nona-1,8-diene.
| Compound Name | (4R,5R)-4-methyl-4,5-bis(prop-2-enoxy)nona-1,8-diene |
|---|---|
| PubChem CID | 10562662 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (4R,5R)-4-methyl-4,5-bis(prop-2-enoxy)nona-1,8-diene |
| SMILES | C=CCC[C@@H](OCC=C)[C@@](C)(CC=C)OCC=C |
| InChI | InChI=1S/C16H26O2/c1-6-10-11-15(17-13-8-3)16(5,12-7-2)18-14-9-4/h6-9,15H,1-4,10-14H2,5H3/t15-,16-/m1/s1 |
| InChIKey | BZZNRMSVLSIISI-HZPDHXFCSA-N |
| XLogP | 4.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|