C3H4Cl3NaO2 — CID 175000936
sodium;hydride;3,3,3-trichloropropanoic acid (PubChem CID 175000936) has the molecular formula C3H4Cl3NaO2 and a molecular weight of 201.41 g/mol. Its IUPAC name is sodium;hydride;3,3,3-trichloropropanoic acid.
| Compound Name | sodium;hydride;3,3,3-trichloropropanoic acid |
|---|---|
| PubChem CID | 175000936 |
| Molecular Formula | C3H4Cl3NaO2 |
| Molecular Weight | 201.41 g/mol |
| Exact Mass | 199.92 |
| IUPAC Name | sodium;hydride;3,3,3-trichloropropanoic acid |
| SMILES | O=C(O)CC(Cl)(Cl)Cl.[H-].[Na+] |
| InChI | InChI=1S/C3H3Cl3O2.Na.H/c4-3(5,6)1-2(7)8;;/h1H2,(H,7,8);;/q;+1;-1 |
| InChIKey | UCZNMWHHEQLXQD-UHFFFAOYSA-N |
| XLogP | -1.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.41 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|