C6H4Cl6O2 — CID 139930599
1,1,1,6,6,6-hexachlorohexane-3,4-dione (PubChem CID 139930599) has the molecular formula C6H4Cl6O2 and a molecular weight of 320.81 g/mol. Its IUPAC name is 1,1,1,6,6,6-hexachlorohexane-3,4-dione.
| Compound Name | 1,1,1,6,6,6-hexachlorohexane-3,4-dione |
|---|---|
| PubChem CID | 139930599 |
| Molecular Formula | C6H4Cl6O2 |
| Molecular Weight | 320.81 g/mol |
| Exact Mass | 317.83 |
| IUPAC Name | 1,1,1,6,6,6-hexachlorohexane-3,4-dione |
| SMILES | O=C(CC(Cl)(Cl)Cl)C(=O)CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H4Cl6O2/c7-5(8,9)1-3(13)4(14)2-6(10,11)12/h1-2H2 |
| InChIKey | KJLWMZZSRPGNCZ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.81 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|