C18H23FN2O4 — CID 175001618
ethyl (E)-3-[2-acetamido-5-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]phenyl]-2-methylprop-2-enoate (PubChem CID 175001618) has the molecular formula C18H23FN2O4 and a molecular weight of 350.39 g/mol. Its IUPAC name is ethyl (E)-3-[2-acetamido-5-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]phenyl]-2-methylprop-2-enoate.
| Compound Name | ethyl (E)-3-[2-acetamido-5-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]phenyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175001618 |
| Molecular Formula | C18H23FN2O4 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | ethyl (E)-3-[2-acetamido-5-[(Z)-2-(aminomethyl)-3-fluoroprop-2-enoxy]phenyl]-2-methylprop-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/c1cc(OC/C(=C\F)CN)ccc1NC(C)=O |
| InChI | InChI=1S/C18H23FN2O4/c1-4-24-18(23)12(2)7-15-8-16(25-11-14(9-19)10-20)5-6-17(15)21-13(3)22/h5-9H,4,10-11,20H2,1-3H3,(H,21,22)/b12-7+,14-9- |
| InChIKey | DDWIMCGXKDZNRS-UWSFHSSNSA-N |
| XLogP | 2.80 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|