C19H15N3O6 — CID 175002845
4-[5-[[2-(4-nitrobenzoyl)hydrazinyl]methyl]furan-2-yl]benzoic acid (PubChem CID 175002845) has the molecular formula C19H15N3O6 and a molecular weight of 381.34 g/mol. Its IUPAC name is 4-[5-[[2-(4-nitrobenzoyl)hydrazinyl]methyl]furan-2-yl]benzoic acid.
| Compound Name | 4-[5-[[2-(4-nitrobenzoyl)hydrazinyl]methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 175002845 |
| Molecular Formula | C19H15N3O6 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 4-[5-[[2-(4-nitrobenzoyl)hydrazinyl]methyl]furan-2-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(CNNC(=O)c3ccc([N+](=O)[O-])cc3)o2)cc1 |
| InChI | InChI=1S/C19H15N3O6/c23-18(13-5-7-15(8-6-13)22(26)27)21-20-11-16-9-10-17(28-16)12-1-3-14(4-2-12)19(24)25/h1-10,20H,11H2,(H,21,23)(H,24,25) |
| InChIKey | AIBUSKJKHQGTKV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 134.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|