C15H28O6 — CID 175002974
carbonic acid;propan-2-yl 2,2-diethyl-5-methyl-3-oxohexanoate (PubChem CID 175002974) has the molecular formula C15H28O6 and a molecular weight of 304.38 g/mol. Its IUPAC name is carbonic acid;propan-2-yl 2,2-diethyl-5-methyl-3-oxohexanoate.
| Compound Name | carbonic acid;propan-2-yl 2,2-diethyl-5-methyl-3-oxohexanoate |
|---|---|
| PubChem CID | 175002974 |
| Molecular Formula | C15H28O6 |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | carbonic acid;propan-2-yl 2,2-diethyl-5-methyl-3-oxohexanoate |
| SMILES | CCC(CC)(C(=O)CC(C)C)C(=O)OC(C)C.O=C(O)O |
| InChI | InChI=1S/C14H26O3.CH2O3/c1-7-14(8-2,12(15)9-10(3)4)13(16)17-11(5)6;2-1(3)4/h10-11H,7-9H2,1-6H3;(H2,2,3,4) |
| InChIKey | YJFSFJUVFSHOHO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|