C18H35CeO6P — CID 175003773
cerium;phosphono (Z,12R)-12-hydroxyoctadec-9-enoate (PubChem CID 175003773) has the molecular formula C18H35CeO6P and a molecular weight of 518.56 g/mol. Its IUPAC name is cerium;phosphono (Z,12R)-12-hydroxyoctadec-9-enoate.
| Compound Name | cerium;phosphono (Z,12R)-12-hydroxyoctadec-9-enoate |
|---|---|
| PubChem CID | 175003773 |
| Molecular Formula | C18H35CeO6P |
| Molecular Weight | 518.56 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | cerium;phosphono (Z,12R)-12-hydroxyoctadec-9-enoate |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)OP(=O)(O)O.[Ce] |
| InChI | InChI=1S/C18H35O6P.Ce/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)24-25(21,22)23;/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H2,21,22,23);/b12-9-;/t17-;/m1./s1 |
| InChIKey | GZQCZDUSBKKWLL-DPMBMXLASA-N |
| XLogP | 4.63 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|