C33H34O7 — CID 175004046
bis(4,4-diphenoxybutyl) carbonate (PubChem CID 175004046) has the molecular formula C33H34O7 and a molecular weight of 542.63 g/mol. Its IUPAC name is bis(4,4-diphenoxybutyl) carbonate.
| Compound Name | bis(4,4-diphenoxybutyl) carbonate |
|---|---|
| PubChem CID | 175004046 |
| Molecular Formula | C33H34O7 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.23 |
| IUPAC Name | bis(4,4-diphenoxybutyl) carbonate |
| SMILES | O=C(OCCCC(Oc1ccccc1)Oc1ccccc1)OCCCC(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C33H34O7/c34-33(35-25-13-23-31(37-27-15-5-1-6-16-27)38-28-17-7-2-8-18-28)36-26-14-24-32(39-29-19-9-3-10-20-29)40-30-21-11-4-12-22-30/h1-12,15-22,31-32H,13-14,23-26H2 |
| InChIKey | BXEPUDLEQDFSOH-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|