About 1-oxidopyridin-1-ium;phosphoric acid
1-oxidopyridin-1-ium;phosphoric acid (PubChem CID 175006762) has the molecular formula C5H8NO5P
and a molecular weight of 193.10 g/mol. Its IUPAC name is 1-oxidopyridin-1-ium;phosphoric acid.
Molecular Properties
| Compound Name | 1-oxidopyridin-1-ium;phosphoric acid |
| PubChem CID | 175006762 |
| Molecular Formula | C5H8NO5P |
| Molecular Weight | 193.10 g/mol |
| Exact Mass | 193.01 |
| IUPAC Name | 1-oxidopyridin-1-ium;phosphoric acid |
| SMILES | O=P(O)(O)O.[O-][n+]1ccccc1 |
| InChI | InChI=1S/C5H5NO.H3O4P/c7-6-4-2-1-3-5-6;1-5(2,3)4/h1-5H;(H3,1,2,3,4) |
| InChIKey | MRBYOJBXSOLZHF-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.10 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-oxidopyridin-1-ium;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxidopyridin-1-ium;phosphoric acid?
The IUPAC name of 1-oxidopyridin-1-ium;phosphoric acid (CID 175006762) is 1-oxidopyridin-1-ium;phosphoric acid.
What is the SMILES notation for 1-oxidopyridin-1-ium;phosphoric acid?
The canonical SMILES for 1-oxidopyridin-1-ium;phosphoric acid is O=P(O)(O)O.[O-][n+]1ccccc1.
What is the InChIKey of 1-oxidopyridin-1-ium;phosphoric acid?
The InChIKey is MRBYOJBXSOLZHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO.H3O4P/c7-6-4-2-1-3-5-6;1-5(2,3)4/h1-5H;(H3,1,2,3,4).
What are the key properties of 1-oxidopyridin-1-ium;phosphoric acid?
1-oxidopyridin-1-ium;phosphoric acid has a molecular weight of 193.10 g/mol, XLogP of -0.61, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxidopyridin-1-ium;phosphoric acid is sourced from PubChem (CID 175006762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).