About 1-oxidopyridin-1-ium
1-oxidopyridin-1-ium (PubChem CID 160920472) has the molecular formula C15H15N3O3
and a molecular weight of 285.30 g/mol. Its IUPAC name is 1-oxidopyridin-1-ium.
Molecular Properties
| Compound Name | 1-oxidopyridin-1-ium |
| PubChem CID | 160920472 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 1-oxidopyridin-1-ium |
| SMILES | [O-][n+]1ccccc1.[O-][n+]1ccccc1.[O-][n+]1ccccc1 |
| InChI | InChI=1S/3C5H5NO/c3*7-6-4-2-1-3-5-6/h3*1-5H |
| InChIKey | SRYQGCCMOIZGGC-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 80.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1-oxidopyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxidopyridin-1-ium?
The IUPAC name of 1-oxidopyridin-1-ium (CID 160920472) is 1-oxidopyridin-1-ium.
What is the SMILES notation for 1-oxidopyridin-1-ium?
The canonical SMILES for 1-oxidopyridin-1-ium is [O-][n+]1ccccc1.[O-][n+]1ccccc1.[O-][n+]1ccccc1.
What is the InChIKey of 1-oxidopyridin-1-ium?
The InChIKey is SRYQGCCMOIZGGC-UHFFFAOYSA-N. The full InChI is InChI=1S/3C5H5NO/c3*7-6-4-2-1-3-5-6/h3*1-5H.
What are the key properties of 1-oxidopyridin-1-ium?
1-oxidopyridin-1-ium has a molecular weight of 285.30 g/mol, XLogP of 0.96, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxidopyridin-1-ium is sourced from PubChem (CID 160920472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).