About 1-tert-butylperoxy-7,7-dimethylnon-1-yne
1-tert-butylperoxy-7,7-dimethylnon-1-yne (PubChem CID 175007739) has the molecular formula C15H28O2
and a molecular weight of 240.39 g/mol. Its IUPAC name is 1-tert-butylperoxy-7,7-dimethylnon-1-yne.
Molecular Properties
| Compound Name | 1-tert-butylperoxy-7,7-dimethylnon-1-yne |
| PubChem CID | 175007739 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 1-tert-butylperoxy-7,7-dimethylnon-1-yne |
| SMILES | CCC(C)(C)CCCCC#COOC(C)(C)C |
| InChI | InChI=1S/C15H28O2/c1-7-15(5,6)12-10-8-9-11-13-16-17-14(2,3)4/h7-10,12H2,1-6H3 |
| InChIKey | LPXTVEYTYLCLLJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butylperoxy-7,7-dimethylnon-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butylperoxy-7,7-dimethylnon-1-yne?
The IUPAC name of 1-tert-butylperoxy-7,7-dimethylnon-1-yne (CID 175007739) is 1-tert-butylperoxy-7,7-dimethylnon-1-yne.
What is the SMILES notation for 1-tert-butylperoxy-7,7-dimethylnon-1-yne?
The canonical SMILES for 1-tert-butylperoxy-7,7-dimethylnon-1-yne is CCC(C)(C)CCCCC#COOC(C)(C)C.
What is the InChIKey of 1-tert-butylperoxy-7,7-dimethylnon-1-yne?
The InChIKey is LPXTVEYTYLCLLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O2/c1-7-15(5,6)12-10-8-9-11-13-16-17-14(2,3)4/h7-10,12H2,1-6H3.
What are the key properties of 1-tert-butylperoxy-7,7-dimethylnon-1-yne?
1-tert-butylperoxy-7,7-dimethylnon-1-yne has a molecular weight of 240.39 g/mol, XLogP of 4.69, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butylperoxy-7,7-dimethylnon-1-yne is sourced from PubChem (CID 175007739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).