About 2-bromo-3,6,9-triazatricyclo[4.3.0.03,8]nona-1,8-diene
2-bromo-3,6,9-triazatricyclo[4.3.0.03,8]nona-1,8-diene (PubChem CID 175007896) has the molecular formula C6H6BrN3
and a molecular weight of 200.04 g/mol. Its IUPAC name is 2-bromo-3,6,9-triazatricyclo[4.3.0.03,8]nona-1,8-diene.
Analyze 2-bromo-3,6,9-triazatricyclo[4.3.0.03,8]nona-1,8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-3,6,9-triazatricyclo[4.3.0.03,8]nona-1,8-diene?
The IUPAC name of 2-bromo-3,6,9-triazatricyclo[4.3.0.03,8]nona-1,8-diene (CID 175007896) is 2-bromo-3,6,9-triazatricyclo[4.3.0.03,8]nona-1,8-diene.
What is the SMILES notation for 2-bromo-3,6,9-triazatricyclo[4.3.0.03,8]nona-1,8-diene?
The canonical SMILES for 2-bromo-3,6,9-triazatricyclo[4.3.0.03,8]nona-1,8-diene is Brc1c2nc3n1CCN2C3.
What is the InChIKey of 2-bromo-3,6,9-triazatricyclo[4.3.0.03,8]nona-1,8-diene?
The InChIKey is DFFHCHOFBBHIOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrN3/c7-5-6-8-4-3-9(6)1-2-10(4)5/h1-3H2.
What are the key properties of 2-bromo-3,6,9-triazatricyclo[4.3.0.03,8]nona-1,8-diene?
2-bromo-3,6,9-triazatricyclo[4.3.0.03,8]nona-1,8-diene has a molecular weight of 200.04 g/mol, XLogP of 0.98, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3,6,9-triazatricyclo[4.3.0.03,8]nona-1,8-diene is sourced from PubChem (CID 175007896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).