C24H22N4O4S — CID 175008156
1-[2,3-bis(2-isocyanatoethyl)phenyl]sulfanyl-2,3-bis(2-isocyanatoethyl)benzene (PubChem CID 175008156) has the molecular formula C24H22N4O4S and a molecular weight of 462.53 g/mol. Its IUPAC name is 1-[2,3-bis(2-isocyanatoethyl)phenyl]sulfanyl-2,3-bis(2-isocyanatoethyl)benzene.
| Compound Name | 1-[2,3-bis(2-isocyanatoethyl)phenyl]sulfanyl-2,3-bis(2-isocyanatoethyl)benzene |
|---|---|
| PubChem CID | 175008156 |
| Molecular Formula | C24H22N4O4S |
| Molecular Weight | 462.53 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | 1-[2,3-bis(2-isocyanatoethyl)phenyl]sulfanyl-2,3-bis(2-isocyanatoethyl)benzene |
| SMILES | O=C=NCCc1cccc(Sc2cccc(CCN=C=O)c2CCN=C=O)c1CCN=C=O |
| InChI | InChI=1S/C24H22N4O4S/c29-15-25-11-7-19-3-1-5-23(21(19)9-13-27-17-31)33-24-6-2-4-20(8-12-26-16-30)22(24)10-14-28-18-32/h1-6H,7-14H2 |
| InChIKey | NWWXJJQALUWLQO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.53 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|