About tris(3-ethylheptan-3-yl) phosphite
tris(3-ethylheptan-3-yl) phosphite (PubChem CID 175009117) has the molecular formula C27H57O3P
and a molecular weight of 460.72 g/mol. Its IUPAC name is tris(3-ethylheptan-3-yl) phosphite.
Molecular Properties
| Compound Name | tris(3-ethylheptan-3-yl) phosphite |
| PubChem CID | 175009117 |
| Molecular Formula | C27H57O3P |
| Molecular Weight | 460.72 g/mol |
| Exact Mass | 460.40 |
| IUPAC Name | tris(3-ethylheptan-3-yl) phosphite |
| SMILES | CCCCC(CC)(CC)OP(OC(CC)(CC)CCCC)OC(CC)(CC)CCCC |
| InChI | InChI=1S/C27H57O3P/c1-10-19-22-25(13-4,14-5)28-31(29-26(15-6,16-7)23-20-11-2)30-27(17-8,18-9)24-21-12-3/h10-24H2,1-9H3 |
| InChIKey | QCBMVOVMBWZACH-UHFFFAOYSA-N |
| XLogP | 10.51 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 460.72 |
| LogP ≤ 5 | 10.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris(3-ethylheptan-3-yl) phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(3-ethylheptan-3-yl) phosphite?
The IUPAC name of tris(3-ethylheptan-3-yl) phosphite (CID 175009117) is tris(3-ethylheptan-3-yl) phosphite.
What is the SMILES notation for tris(3-ethylheptan-3-yl) phosphite?
The canonical SMILES for tris(3-ethylheptan-3-yl) phosphite is CCCCC(CC)(CC)OP(OC(CC)(CC)CCCC)OC(CC)(CC)CCCC.
What is the InChIKey of tris(3-ethylheptan-3-yl) phosphite?
The InChIKey is QCBMVOVMBWZACH-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H57O3P/c1-10-19-22-25(13-4,14-5)28-31(29-26(15-6,16-7)23-20-11-2)30-27(17-8,18-9)24-21-12-3/h10-24H2,1-9H3.
What are the key properties of tris(3-ethylheptan-3-yl) phosphite?
tris(3-ethylheptan-3-yl) phosphite has a molecular weight of 460.72 g/mol, XLogP of 10.51, 21 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tris(3-ethylheptan-3-yl) phosphite is sourced from PubChem (CID 175009117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).