C15H23N3O2 — CID 175011693
(2-methyl-2-phenylpropyl) 3-aminopiperazine-1-carboxylate (PubChem CID 175011693) has the molecular formula C15H23N3O2 and a molecular weight of 277.37 g/mol. Its IUPAC name is (2-methyl-2-phenylpropyl) 3-aminopiperazine-1-carboxylate.
| Compound Name | (2-methyl-2-phenylpropyl) 3-aminopiperazine-1-carboxylate |
|---|---|
| PubChem CID | 175011693 |
| Molecular Formula | C15H23N3O2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | (2-methyl-2-phenylpropyl) 3-aminopiperazine-1-carboxylate |
| SMILES | CC(C)(COC(=O)N1CCNC(N)C1)c1ccccc1 |
| InChI | InChI=1S/C15H23N3O2/c1-15(2,12-6-4-3-5-7-12)11-20-14(19)18-9-8-17-13(16)10-18/h3-7,13,17H,8-11,16H2,1-2H3 |
| InChIKey | LYMJSQPBIYDVBF-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |