C24H39N3 — CID 175013598
1,4-bis(2-ethylhexyl)-5-phenyltriazole (PubChem CID 175013598) has the molecular formula C24H39N3 and a molecular weight of 369.60 g/mol. Its IUPAC name is 1,4-bis(2-ethylhexyl)-5-phenyltriazole.
| Compound Name | 1,4-bis(2-ethylhexyl)-5-phenyltriazole |
|---|---|
| PubChem CID | 175013598 |
| Molecular Formula | C24H39N3 |
| Molecular Weight | 369.60 g/mol |
| Exact Mass | 369.31 |
| IUPAC Name | 1,4-bis(2-ethylhexyl)-5-phenyltriazole |
| SMILES | CCCCC(CC)Cc1nnn(CC(CC)CCCC)c1-c1ccccc1 |
| InChI | InChI=1S/C24H39N3/c1-5-9-14-20(7-3)18-23-24(22-16-12-11-13-17-22)27(26-25-23)19-21(8-4)15-10-6-2/h11-13,16-17,20-21H,5-10,14-15,18-19H2,1-4H3 |
| InChIKey | MDNBBLWGRSTAGN-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.60 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |