C24H42N4 — CID 57277872
7-(benzotriazol-1-ylmethyl)-5,9-diethyltridecan-7-amine (PubChem CID 57277872) has the molecular formula C24H42N4 and a molecular weight of 386.63 g/mol. Its IUPAC name is 7-(benzotriazol-1-ylmethyl)-5,9-diethyltridecan-7-amine.
| Compound Name | 7-(benzotriazol-1-ylmethyl)-5,9-diethyltridecan-7-amine |
|---|---|
| PubChem CID | 57277872 |
| Molecular Formula | C24H42N4 |
| Molecular Weight | 386.63 g/mol |
| Exact Mass | 386.34 |
| IUPAC Name | 7-(benzotriazol-1-ylmethyl)-5,9-diethyltridecan-7-amine |
| SMILES | CCCCC(CC)CC(N)(CC(CC)CCCC)Cn1nnc2ccccc21 |
| InChI | InChI=1S/C24H42N4/c1-5-9-13-20(7-3)17-24(25,18-21(8-4)14-10-6-2)19-28-23-16-12-11-15-22(23)26-27-28/h11-12,15-16,20-21H,5-10,13-14,17-19,25H2,1-4H3 |
| InChIKey | ZLPCAEUJBUFCLP-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.63 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |