C24H42N4 — CID 54144406
5,9-diethyl-7-(4-methylbenzotriazol-1-yl)tridecan-7-amine (PubChem CID 54144406) has the molecular formula C24H42N4 and a molecular weight of 386.63 g/mol. Its IUPAC name is 5,9-diethyl-7-(4-methylbenzotriazol-1-yl)tridecan-7-amine.
| Compound Name | 5,9-diethyl-7-(4-methylbenzotriazol-1-yl)tridecan-7-amine |
|---|---|
| PubChem CID | 54144406 |
| Molecular Formula | C24H42N4 |
| Molecular Weight | 386.63 g/mol |
| Exact Mass | 386.34 |
| IUPAC Name | 5,9-diethyl-7-(4-methylbenzotriazol-1-yl)tridecan-7-amine |
| SMILES | CCCCC(CC)CC(N)(CC(CC)CCCC)n1nnc2c(C)cccc21 |
| InChI | InChI=1S/C24H42N4/c1-6-10-14-20(8-3)17-24(25,18-21(9-4)15-11-7-2)28-22-16-12-13-19(5)23(22)26-27-28/h12-13,16,20-21H,6-11,14-15,17-18,25H2,1-5H3 |
| InChIKey | ODIRCEMRICGASB-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.63 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |