C24H42N4 — CID 100913241
(3R)-N-[(2S)-2-ethylhexyl]-N-[(4-methylbenzotriazol-1-yl)methyl]octan-3-amine (PubChem CID 100913241) has the molecular formula C24H42N4 and a molecular weight of 386.63 g/mol. Its IUPAC name is (3R)-N-[(2S)-2-ethylhexyl]-N-[(4-methylbenzotriazol-1-yl)methyl]octan-3-amine.
| Compound Name | (3R)-N-[(2S)-2-ethylhexyl]-N-[(4-methylbenzotriazol-1-yl)methyl]octan-3-amine |
|---|---|
| PubChem CID | 100913241 |
| Molecular Formula | C24H42N4 |
| Molecular Weight | 386.63 g/mol |
| Exact Mass | 386.34 |
| IUPAC Name | (3R)-N-[(2S)-2-ethylhexyl]-N-[(4-methylbenzotriazol-1-yl)methyl]octan-3-amine |
| SMILES | CCCCC[C@@H](CC)N(C[C@@H](CC)CCCC)Cn1nnc2c(C)cccc21 |
| InChI | InChI=1S/C24H42N4/c1-6-10-12-16-22(9-4)27(18-21(8-3)15-11-7-2)19-28-23-17-13-14-20(5)24(23)25-26-28/h13-14,17,21-22H,6-12,15-16,18-19H2,1-5H3/t21-,22+/m0/s1 |
| InChIKey | LJBPXRPIIKMWOG-FCHUYYIVSA-N |
| XLogP | 6.57 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.63 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|