C11H16N4 — CID 175951932
N,N-dimethyl-2-(4-methylbenzotriazol-1-yl)ethanamine (PubChem CID 175951932) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is N,N-dimethyl-2-(4-methylbenzotriazol-1-yl)ethanamine.
| Compound Name | N,N-dimethyl-2-(4-methylbenzotriazol-1-yl)ethanamine |
|---|---|
| PubChem CID | 175951932 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | N,N-dimethyl-2-(4-methylbenzotriazol-1-yl)ethanamine |
| SMILES | Cc1cccc2c1nnn2CCN(C)C |
| InChI | InChI=1S/C11H16N4/c1-9-5-4-6-10-11(9)12-13-15(10)8-7-14(2)3/h4-6H,7-8H2,1-3H3 |
| InChIKey | UKNOIYFJWSSDRX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |