C14H20N4O2 — CID 175951948
3-[1-[2-(dimethylamino)ethyl]-4-methylbenzotriazol-5-yl]propanoic acid (PubChem CID 175951948) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is 3-[1-[2-(dimethylamino)ethyl]-4-methylbenzotriazol-5-yl]propanoic acid.
| Compound Name | 3-[1-[2-(dimethylamino)ethyl]-4-methylbenzotriazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 175951948 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | 3-[1-[2-(dimethylamino)ethyl]-4-methylbenzotriazol-5-yl]propanoic acid |
| SMILES | Cc1c(CCC(=O)O)ccc2c1nnn2CCN(C)C |
| InChI | InChI=1S/C14H20N4O2/c1-10-11(5-7-13(19)20)4-6-12-14(10)15-16-18(12)9-8-17(2)3/h4,6H,5,7-9H2,1-3H3,(H,19,20) |
| InChIKey | LGYPUNIPFZTDNP-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |