C21H25N3O4 — CID 175838702
(3-methoxyphenyl) 3-[1-(4-hydroxybutyl)-4-methylbenzotriazol-5-yl]propanoate (PubChem CID 175838702) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is (3-methoxyphenyl) 3-[1-(4-hydroxybutyl)-4-methylbenzotriazol-5-yl]propanoate.
| Compound Name | (3-methoxyphenyl) 3-[1-(4-hydroxybutyl)-4-methylbenzotriazol-5-yl]propanoate |
|---|---|
| PubChem CID | 175838702 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | (3-methoxyphenyl) 3-[1-(4-hydroxybutyl)-4-methylbenzotriazol-5-yl]propanoate |
| SMILES | COc1cccc(OC(=O)CCc2ccc3c(nnn3CCCCO)c2C)c1 |
| InChI | InChI=1S/C21H25N3O4/c1-15-16(8-10-19-21(15)22-23-24(19)12-3-4-13-25)9-11-20(26)28-18-7-5-6-17(14-18)27-2/h5-8,10,14,25H,3-4,9,11-13H2,1-2H3 |
| InChIKey | HHBXVJROGDONTM-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|