C20H24N4O3 — CID 175838576
3-[1-[2-[N-(2-hydroxyethyl)anilino]ethyl]-4-methylbenzotriazol-5-yl]propanoic acid (PubChem CID 175838576) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 3-[1-[2-[N-(2-hydroxyethyl)anilino]ethyl]-4-methylbenzotriazol-5-yl]propanoic acid.
| Compound Name | 3-[1-[2-[N-(2-hydroxyethyl)anilino]ethyl]-4-methylbenzotriazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 175838576 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 3-[1-[2-[N-(2-hydroxyethyl)anilino]ethyl]-4-methylbenzotriazol-5-yl]propanoic acid |
| SMILES | Cc1c(CCC(=O)O)ccc2c1nnn2CCN(CCO)c1ccccc1 |
| InChI | InChI=1S/C20H24N4O3/c1-15-16(8-10-19(26)27)7-9-18-20(15)21-22-24(18)12-11-23(13-14-25)17-5-3-2-4-6-17/h2-7,9,25H,8,10-14H2,1H3,(H,26,27) |
| InChIKey | NFJCJZPGUJLVQP-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |