C12H15N3O3 — CID 175838680
3-[1-(2-hydroxyethyl)-4-methylbenzotriazol-5-yl]propanoic acid (PubChem CID 175838680) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is 3-[1-(2-hydroxyethyl)-4-methylbenzotriazol-5-yl]propanoic acid.
| Compound Name | 3-[1-(2-hydroxyethyl)-4-methylbenzotriazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 175838680 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 3-[1-(2-hydroxyethyl)-4-methylbenzotriazol-5-yl]propanoic acid |
| SMILES | Cc1c(CCC(=O)O)ccc2c1nnn2CCO |
| InChI | InChI=1S/C12H15N3O3/c1-8-9(3-5-11(17)18)2-4-10-12(8)13-14-15(10)6-7-16/h2,4,16H,3,5-7H2,1H3,(H,17,18) |
| InChIKey | KLENLMHGRFHLEU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |