C18H19BrO4 — CID 1406365
(3-methylphenyl) 3-(2-bromo-4,5-dimethoxyphenyl)propanoate (PubChem CID 1406365) has the molecular formula C18H19BrO4 and a molecular weight of 379.25 g/mol. Its IUPAC name is (3-methylphenyl) 3-(2-bromo-4,5-dimethoxyphenyl)propanoate.
| Compound Name | (3-methylphenyl) 3-(2-bromo-4,5-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 1406365 |
| Molecular Formula | C18H19BrO4 |
| Molecular Weight | 379.25 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | (3-methylphenyl) 3-(2-bromo-4,5-dimethoxyphenyl)propanoate |
| SMILES | COc1cc(Br)c(CCC(=O)Oc2cccc(C)c2)cc1OC |
| InChI | InChI=1S/C18H19BrO4/c1-12-5-4-6-14(9-12)23-18(20)8-7-13-10-16(21-2)17(22-3)11-15(13)19/h4-6,9-11H,7-8H2,1-3H3 |
| InChIKey | PSIPEFWBJJDKSA-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.25 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|