C17H17BrO4 — CID 1406363
phenyl 3-(2-bromo-4,5-dimethoxyphenyl)propanoate (PubChem CID 1406363) has the molecular formula C17H17BrO4 and a molecular weight of 365.22 g/mol. Its IUPAC name is phenyl 3-(2-bromo-4,5-dimethoxyphenyl)propanoate.
| Compound Name | phenyl 3-(2-bromo-4,5-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 1406363 |
| Molecular Formula | C17H17BrO4 |
| Molecular Weight | 365.22 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | phenyl 3-(2-bromo-4,5-dimethoxyphenyl)propanoate |
| SMILES | COc1cc(Br)c(CCC(=O)Oc2ccccc2)cc1OC |
| InChI | InChI=1S/C17H17BrO4/c1-20-15-10-12(14(18)11-16(15)21-2)8-9-17(19)22-13-6-4-3-5-7-13/h3-7,10-11H,8-9H2,1-2H3 |
| InChIKey | JFAAYLXFGPTFOI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.22 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|