C23H21BrO4 — CID 19220763
(2-bromo-4-phenylphenyl) 3-(3,4-dimethoxyphenyl)propanoate (PubChem CID 19220763) has the molecular formula C23H21BrO4 and a molecular weight of 441.32 g/mol. Its IUPAC name is (2-bromo-4-phenylphenyl) 3-(3,4-dimethoxyphenyl)propanoate.
| Compound Name | (2-bromo-4-phenylphenyl) 3-(3,4-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 19220763 |
| Molecular Formula | C23H21BrO4 |
| Molecular Weight | 441.32 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | (2-bromo-4-phenylphenyl) 3-(3,4-dimethoxyphenyl)propanoate |
| SMILES | COc1ccc(CCC(=O)Oc2ccc(-c3ccccc3)cc2Br)cc1OC |
| InChI | InChI=1S/C23H21BrO4/c1-26-21-11-8-16(14-22(21)27-2)9-13-23(25)28-20-12-10-18(15-19(20)24)17-6-4-3-5-7-17/h3-8,10-12,14-15H,9,13H2,1-2H3 |
| InChIKey | YPEPPUJVKWGXPE-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.32 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|