About 2-bromo-1-methoxy-4-phenylbenzene;2-bromo-4-phenylphenol
2-bromo-1-methoxy-4-phenylbenzene;2-bromo-4-phenylphenol (PubChem CID 158310108) has the molecular formula C25H20Br2O2
and a molecular weight of 512.24 g/mol. Its IUPAC name is 2-bromo-1-methoxy-4-phenylbenzene;2-bromo-4-phenylphenol.
Molecular Properties
| Compound Name | 2-bromo-1-methoxy-4-phenylbenzene;2-bromo-4-phenylphenol |
| PubChem CID | 158310108 |
| Molecular Formula | C25H20Br2O2 |
| Molecular Weight | 512.24 g/mol |
| Exact Mass | 509.98 |
| IUPAC Name | 2-bromo-1-methoxy-4-phenylbenzene;2-bromo-4-phenylphenol |
| SMILES | COc1ccc(-c2ccccc2)cc1Br.Oc1ccc(-c2ccccc2)cc1Br |
| InChI | InChI=1S/C13H11BrO.C12H9BrO/c1-15-13-8-7-11(9-12(13)14)10-5-3-2-4-6-10;13-11-8-10(6-7-12(11)14)9-4-2-1-3-5-9/h2-9H,1H3;1-8,14H |
| InChIKey | GNOPSHLWWJFTCA-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.24 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-bromo-1-methoxy-4-phenylbenzene;2-bromo-4-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-methoxy-4-phenylbenzene;2-bromo-4-phenylphenol?
The IUPAC name of 2-bromo-1-methoxy-4-phenylbenzene;2-bromo-4-phenylphenol (CID 158310108) is 2-bromo-1-methoxy-4-phenylbenzene;2-bromo-4-phenylphenol.
What is the SMILES notation for 2-bromo-1-methoxy-4-phenylbenzene;2-bromo-4-phenylphenol?
The canonical SMILES for 2-bromo-1-methoxy-4-phenylbenzene;2-bromo-4-phenylphenol is COc1ccc(-c2ccccc2)cc1Br.Oc1ccc(-c2ccccc2)cc1Br.
What is the InChIKey of 2-bromo-1-methoxy-4-phenylbenzene;2-bromo-4-phenylphenol?
The InChIKey is GNOPSHLWWJFTCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrO.C12H9BrO/c1-15-13-8-7-11(9-12(13)14)10-5-3-2-4-6-10;13-11-8-10(6-7-12(11)14)9-4-2-1-3-5-9/h2-9H,1H3;1-8,14H.
What are the key properties of 2-bromo-1-methoxy-4-phenylbenzene;2-bromo-4-phenylphenol?
2-bromo-1-methoxy-4-phenylbenzene;2-bromo-4-phenylphenol has a molecular weight of 512.24 g/mol, XLogP of 7.95, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-methoxy-4-phenylbenzene;2-bromo-4-phenylphenol is sourced from PubChem (CID 158310108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).