About (2-bromo-4-phenylphenyl) sulfamate
(2-bromo-4-phenylphenyl) sulfamate (PubChem CID 23508489) has the molecular formula C12H10BrNO3S
and a molecular weight of 328.19 g/mol. Its IUPAC name is (2-bromo-4-phenylphenyl) sulfamate.
Molecular Properties
| Compound Name | (2-bromo-4-phenylphenyl) sulfamate |
| PubChem CID | 23508489 |
| Molecular Formula | C12H10BrNO3S |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 326.96 |
| IUPAC Name | (2-bromo-4-phenylphenyl) sulfamate |
| SMILES | NS(=O)(=O)Oc1ccc(-c2ccccc2)cc1Br |
| InChI | InChI=1S/C12H10BrNO3S/c13-11-8-10(9-4-2-1-3-5-9)6-7-12(11)17-18(14,15)16/h1-8H,(H2,14,15,16) |
| InChIKey | ODAWZBIQOFWUPO-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-bromo-4-phenylphenyl) sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-4-phenylphenyl) sulfamate?
The IUPAC name of (2-bromo-4-phenylphenyl) sulfamate (CID 23508489) is (2-bromo-4-phenylphenyl) sulfamate.
What is the SMILES notation for (2-bromo-4-phenylphenyl) sulfamate?
The canonical SMILES for (2-bromo-4-phenylphenyl) sulfamate is NS(=O)(=O)Oc1ccc(-c2ccccc2)cc1Br.
What is the InChIKey of (2-bromo-4-phenylphenyl) sulfamate?
The InChIKey is ODAWZBIQOFWUPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10BrNO3S/c13-11-8-10(9-4-2-1-3-5-9)6-7-12(11)17-18(14,15)16/h1-8H,(H2,14,15,16).
What are the key properties of (2-bromo-4-phenylphenyl) sulfamate?
(2-bromo-4-phenylphenyl) sulfamate has a molecular weight of 328.19 g/mol, XLogP of 2.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-4-phenylphenyl) sulfamate is sourced from PubChem (CID 23508489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).