About (2-bromo-4-fluorophenyl) sulfamate
(2-bromo-4-fluorophenyl) sulfamate (PubChem CID 130674788) has the molecular formula C6H5BrFNO3S
and a molecular weight of 270.08 g/mol. Its IUPAC name is (2-bromo-4-fluorophenyl) sulfamate.
Molecular Properties
| Compound Name | (2-bromo-4-fluorophenyl) sulfamate |
| PubChem CID | 130674788 |
| Molecular Formula | C6H5BrFNO3S |
| Molecular Weight | 270.08 g/mol |
| Exact Mass | 268.92 |
| IUPAC Name | (2-bromo-4-fluorophenyl) sulfamate |
| SMILES | NS(=O)(=O)Oc1ccc(F)cc1Br |
| InChI | InChI=1S/C6H5BrFNO3S/c7-5-3-4(8)1-2-6(5)12-13(9,10)11/h1-3H,(H2,9,10,11) |
| InChIKey | XCBOHMGGVQSGGC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.08 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-bromo-4-fluorophenyl) sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromo-4-fluorophenyl) sulfamate?
The IUPAC name of (2-bromo-4-fluorophenyl) sulfamate (CID 130674788) is (2-bromo-4-fluorophenyl) sulfamate.
What is the SMILES notation for (2-bromo-4-fluorophenyl) sulfamate?
The canonical SMILES for (2-bromo-4-fluorophenyl) sulfamate is NS(=O)(=O)Oc1ccc(F)cc1Br.
What is the InChIKey of (2-bromo-4-fluorophenyl) sulfamate?
The InChIKey is XCBOHMGGVQSGGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrFNO3S/c7-5-3-4(8)1-2-6(5)12-13(9,10)11/h1-3H,(H2,9,10,11).
What are the key properties of (2-bromo-4-fluorophenyl) sulfamate?
(2-bromo-4-fluorophenyl) sulfamate has a molecular weight of 270.08 g/mol, XLogP of 1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromo-4-fluorophenyl) sulfamate is sourced from PubChem (CID 130674788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).