C24H43N5 — CID 22217665
1-(benzotriazol-1-yl)-N,N'-bis(2-ethylhexyl)ethane-1,2-diamine (PubChem CID 22217665) has the molecular formula C24H43N5 and a molecular weight of 401.64 g/mol. Its IUPAC name is 1-(benzotriazol-1-yl)-N,N'-bis(2-ethylhexyl)ethane-1,2-diamine.
| Compound Name | 1-(benzotriazol-1-yl)-N,N'-bis(2-ethylhexyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 22217665 |
| Molecular Formula | C24H43N5 |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.35 |
| IUPAC Name | 1-(benzotriazol-1-yl)-N,N'-bis(2-ethylhexyl)ethane-1,2-diamine |
| SMILES | CCCCC(CC)CNCC(NCC(CC)CCCC)n1nnc2ccccc21 |
| InChI | InChI=1S/C24H43N5/c1-5-9-13-20(7-3)17-25-19-24(26-18-21(8-4)14-10-6-2)29-23-16-12-11-15-22(23)27-28-29/h11-12,15-16,20-21,24-26H,5-10,13-14,17-19H2,1-4H3 |
| InChIKey | OTLDCMCPQVBZAU-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |