C31H32ClN7O4 — CID 175014032
[(3R)-1-[(3S)-2,3-diamino-3-[7-chloro-1-(pyrimidin-5-ylmethyl)indol-2-yl]-7-oxatricyclo[6.3.1.04,12]dodeca-1(12),8,10-triene-10-carbonyl]piperidin-3-yl] carbamate (PubChem CID 175014032) has the molecular formula C31H32ClN7O4 and a molecular weight of 602.10 g/mol. Its IUPAC name is [(3R)-1-[(3S)-2,3-diamino-3-[7-chloro-1-(pyrimidin-5-ylmethyl)indol-2-yl]-7-oxatricyclo[6.3.1.04,12]dodeca-1(12),8,10-triene-10-carbonyl]piperidin-3-yl] carbamate.
| Compound Name | [(3R)-1-[(3S)-2,3-diamino-3-[7-chloro-1-(pyrimidin-5-ylmethyl)indol-2-yl]-7-oxatricyclo[6.3.1.04,12]dodeca-1(12),8,10-triene-10-carbonyl]piperidin-3-yl] carbamate |
|---|---|
| PubChem CID | 175014032 |
| Molecular Formula | C31H32ClN7O4 |
| Molecular Weight | 602.10 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | [(3R)-1-[(3S)-2,3-diamino-3-[7-chloro-1-(pyrimidin-5-ylmethyl)indol-2-yl]-7-oxatricyclo[6.3.1.04,12]dodeca-1(12),8,10-triene-10-carbonyl]piperidin-3-yl] carbamate |
| SMILES | NC(=O)O[C@@H]1CCCN(C(=O)c2cc3c4c(c2)C(N)[C@](N)(c2cc5cccc(Cl)c5n2Cc2cncnc2)C4CCO3)C1 |
| InChI | InChI=1S/C31H32ClN7O4/c32-23-5-1-3-18-11-25(39(27(18)23)14-17-12-36-16-37-13-17)31(35)22-6-8-42-24-10-19(9-21(26(22)24)28(31)33)29(40)38-7-2-4-20(15-38)43-30(34)41/h1,3,5,9-13,16,20,22,28H,2,4,6-8,14-15,33,35H2,(H2,34,41)/t20-,22?,28?,31-/m1/s1 |
| InChIKey | GXLYWNXGGDGGGV-IQHVNEMJSA-N |
| XLogP | 3.57 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.10 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |