C30H33ClFN5O4 — CID 175018176
[(3R)-1-[(3S)-2,3-diamino-3-[7-chloro-1-(cyclopropylmethyl)-6-fluoroindol-2-yl]-7-oxatricyclo[6.3.1.04,12]dodeca-1(12),8,10-triene-10-carbonyl]piperidin-3-yl] carbamate (PubChem CID 175018176) has the molecular formula C30H33ClFN5O4 and a molecular weight of 582.08 g/mol. Its IUPAC name is [(3R)-1-[(3S)-2,3-diamino-3-[7-chloro-1-(cyclopropylmethyl)-6-fluoroindol-2-yl]-7-oxatricyclo[6.3.1.04,12]dodeca-1(12),8,10-triene-10-carbonyl]piperidin-3-yl] carbamate.
| Compound Name | [(3R)-1-[(3S)-2,3-diamino-3-[7-chloro-1-(cyclopropylmethyl)-6-fluoroindol-2-yl]-7-oxatricyclo[6.3.1.04,12]dodeca-1(12),8,10-triene-10-carbonyl]piperidin-3-yl] carbamate |
|---|---|
| PubChem CID | 175018176 |
| Molecular Formula | C30H33ClFN5O4 |
| Molecular Weight | 582.08 g/mol |
| Exact Mass | 581.22 |
| IUPAC Name | [(3R)-1-[(3S)-2,3-diamino-3-[7-chloro-1-(cyclopropylmethyl)-6-fluoroindol-2-yl]-7-oxatricyclo[6.3.1.04,12]dodeca-1(12),8,10-triene-10-carbonyl]piperidin-3-yl] carbamate |
| SMILES | NC(=O)O[C@@H]1CCCN(C(=O)c2cc3c4c(c2)C(N)[C@](N)(c2cc5ccc(F)c(Cl)c5n2CC2CC2)C4CCO3)C1 |
| InChI | InChI=1S/C30H33ClFN5O4/c31-25-21(32)6-5-16-12-23(37(26(16)25)13-15-3-4-15)30(35)20-7-9-40-22-11-17(10-19(24(20)22)27(30)33)28(38)36-8-1-2-18(14-36)41-29(34)39/h5-6,10-12,15,18,20,27H,1-4,7-9,13-14,33,35H2,(H2,34,39)/t18-,20?,27?,30-/m1/s1 |
| InChIKey | VLJQNAUCWAYXBI-SUVCTMDRSA-N |
| XLogP | 4.28 |
| TPSA | 138.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.08 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |