C15H19NO4 — CID 175015821
[(2R)-2-[(3,5-dimethylphenoxy)carbonylamino]propyl] prop-2-enoate (PubChem CID 175015821) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is [(2R)-2-[(3,5-dimethylphenoxy)carbonylamino]propyl] prop-2-enoate.
| Compound Name | [(2R)-2-[(3,5-dimethylphenoxy)carbonylamino]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 175015821 |
| Molecular Formula | C15H19NO4 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | [(2R)-2-[(3,5-dimethylphenoxy)carbonylamino]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OC[C@@H](C)NC(=O)Oc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C15H19NO4/c1-5-14(17)19-9-12(4)16-15(18)20-13-7-10(2)6-11(3)8-13/h5-8,12H,1,9H2,2-4H3,(H,16,18)/t12-/m1/s1 |
| InChIKey | RKCFECGUZLPSBY-GFCCVEGCSA-N |
| XLogP | 2.51 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|