C10H18NO4+ — CID 90396677
carboxymethyl-dimethyl-(1-prop-2-enoyloxypropan-2-yl)azanium (PubChem CID 90396677) has the molecular formula C10H18NO4+ and a molecular weight of 216.26 g/mol. Its IUPAC name is carboxymethyl-dimethyl-(1-prop-2-enoyloxypropan-2-yl)azanium.
| Compound Name | carboxymethyl-dimethyl-(1-prop-2-enoyloxypropan-2-yl)azanium |
|---|---|
| PubChem CID | 90396677 |
| Molecular Formula | C10H18NO4+ |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | carboxymethyl-dimethyl-(1-prop-2-enoyloxypropan-2-yl)azanium |
| SMILES | C=CC(=O)OCC(C)[N+](C)(C)CC(=O)O |
| InChI | InChI=1S/C10H17NO4/c1-5-10(14)15-7-8(2)11(3,4)6-9(12)13/h5,8H,1,6-7H2,2-4H3/p+1 |
| InChIKey | CZYYDYGIIHUGIO-UHFFFAOYSA-O |
| XLogP | 0.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|