C9H18ClNO2 — CID 87502467
trimethyl(1-prop-2-enoyloxypropan-2-yl)azanium chloride (PubChem CID 87502467) has the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. Its IUPAC name is trimethyl(1-prop-2-enoyloxypropan-2-yl)azanium chloride.
| Compound Name | trimethyl(1-prop-2-enoyloxypropan-2-yl)azanium chloride |
|---|---|
| PubChem CID | 87502467 |
| Molecular Formula | C9H18ClNO2 |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | trimethyl(1-prop-2-enoyloxypropan-2-yl)azanium chloride |
| SMILES | C=CC(=O)OCC(C)[N+](C)(C)C.[Cl-] |
| InChI | InChI=1S/C9H18NO2.ClH/c1-6-9(11)12-7-8(2)10(3,4)5;/h6,8H,1,7H2,2-5H3;1H/q+1;/p-1 |
| InChIKey | GEXNGGRUIXPHHW-UHFFFAOYSA-M |
| XLogP | -2.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|