C22H27FN6O5S — CID 175016546
[(3R)-1-[2-[4-(2-fluoro-4-methylsulfonylanilino)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-7-yl]acetyl]piperidin-3-yl] carbamate (PubChem CID 175016546) has the molecular formula C22H27FN6O5S and a molecular weight of 506.56 g/mol. Its IUPAC name is [(3R)-1-[2-[4-(2-fluoro-4-methylsulfonylanilino)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-7-yl]acetyl]piperidin-3-yl] carbamate.
| Compound Name | [(3R)-1-[2-[4-(2-fluoro-4-methylsulfonylanilino)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-7-yl]acetyl]piperidin-3-yl] carbamate |
|---|---|
| PubChem CID | 175016546 |
| Molecular Formula | C22H27FN6O5S |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.17 |
| IUPAC Name | [(3R)-1-[2-[4-(2-fluoro-4-methylsulfonylanilino)-5,6,7,8-tetrahydropyrido[4,3-d]pyrimidin-7-yl]acetyl]piperidin-3-yl] carbamate |
| SMILES | CS(=O)(=O)c1ccc(Nc2ncnc3c2CNC(CC(=O)N2CCC[C@@H](OC(N)=O)C2)C3)c(F)c1 |
| InChI | InChI=1S/C22H27FN6O5S/c1-35(32,33)15-4-5-18(17(23)9-15)28-21-16-10-25-13(7-19(16)26-12-27-21)8-20(30)29-6-2-3-14(11-29)34-22(24)31/h4-5,9,12-14,25H,2-3,6-8,10-11H2,1H3,(H2,24,31)(H,26,27,28)/t13?,14-/m1/s1 |
| InChIKey | VDBFVFVZYYRPDL-ARLHGKGLSA-N |
| XLogP | 1.25 |
| TPSA | 156.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |