About 2-fluoro-4-hydroxybenzonitrile;5-fluoropyridin-3-ol
2-fluoro-4-hydroxybenzonitrile;5-fluoropyridin-3-ol (PubChem CID 175017807) has the molecular formula C12H8F2N2O2
and a molecular weight of 250.20 g/mol. Its IUPAC name is 2-fluoro-4-hydroxybenzonitrile;5-fluoropyridin-3-ol.
Molecular Properties
| Compound Name | 2-fluoro-4-hydroxybenzonitrile;5-fluoropyridin-3-ol |
| PubChem CID | 175017807 |
| Molecular Formula | C12H8F2N2O2 |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 2-fluoro-4-hydroxybenzonitrile;5-fluoropyridin-3-ol |
| SMILES | N#Cc1ccc(O)cc1F.Oc1cncc(F)c1 |
| InChI | InChI=1S/C7H4FNO.C5H4FNO/c8-7-3-6(10)2-1-5(7)4-9;6-4-1-5(8)3-7-2-4/h1-3,10H;1-3,8H |
| InChIKey | KQWZRGFWEUUERO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 77.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoro-4-hydroxybenzonitrile;5-fluoropyridin-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-hydroxybenzonitrile;5-fluoropyridin-3-ol?
The IUPAC name of 2-fluoro-4-hydroxybenzonitrile;5-fluoropyridin-3-ol (CID 175017807) is 2-fluoro-4-hydroxybenzonitrile;5-fluoropyridin-3-ol.
What is the SMILES notation for 2-fluoro-4-hydroxybenzonitrile;5-fluoropyridin-3-ol?
The canonical SMILES for 2-fluoro-4-hydroxybenzonitrile;5-fluoropyridin-3-ol is N#Cc1ccc(O)cc1F.Oc1cncc(F)c1.
What is the InChIKey of 2-fluoro-4-hydroxybenzonitrile;5-fluoropyridin-3-ol?
The InChIKey is KQWZRGFWEUUERO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4FNO.C5H4FNO/c8-7-3-6(10)2-1-5(7)4-9;6-4-1-5(8)3-7-2-4/h1-3,10H;1-3,8H.
What are the key properties of 2-fluoro-4-hydroxybenzonitrile;5-fluoropyridin-3-ol?
2-fluoro-4-hydroxybenzonitrile;5-fluoropyridin-3-ol has a molecular weight of 250.20 g/mol, XLogP of 2.33, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-hydroxybenzonitrile;5-fluoropyridin-3-ol is sourced from PubChem (CID 175017807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).