C17H29NO6 — CID 175017982
2-[(2S,3R,4S)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxy-N-undec-1-enylacetamide (PubChem CID 175017982) has the molecular formula C17H29NO6 and a molecular weight of 343.42 g/mol. Its IUPAC name is 2-[(2S,3R,4S)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxy-N-undec-1-enylacetamide.
| Compound Name | 2-[(2S,3R,4S)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxy-N-undec-1-enylacetamide |
|---|---|
| PubChem CID | 175017982 |
| Molecular Formula | C17H29NO6 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | 2-[(2S,3R,4S)-3,4-dihydroxy-5-oxooxolan-2-yl]-2-hydroxy-N-undec-1-enylacetamide |
| SMILES | CCCCCCCCCC=CNC(=O)C(O)[C@H]1OC(=O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H29NO6/c1-2-3-4-5-6-7-8-9-10-11-18-16(22)14(21)15-12(19)13(20)17(23)24-15/h10-15,19-21H,2-9H2,1H3,(H,18,22)/t12-,13+,14?,15+/m1/s1 |
| InChIKey | ZFPYROSMNBFAJB-VPHRMDQISA-N |
| XLogP | 0.77 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|