C9H14ClZr- — CID 175020191
2-tert-butylcyclopenta-1,3-diene;zirconium;hydrochloride (PubChem CID 175020191) has the molecular formula C9H14ClZr- and a molecular weight of 248.89 g/mol. Its IUPAC name is 2-tert-butylcyclopenta-1,3-diene;zirconium;hydrochloride.
| Compound Name | 2-tert-butylcyclopenta-1,3-diene;zirconium;hydrochloride |
|---|---|
| PubChem CID | 175020191 |
| Molecular Formula | C9H14ClZr- |
| Molecular Weight | 248.89 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | 2-tert-butylcyclopenta-1,3-diene;zirconium;hydrochloride |
| SMILES | CC(C)(C)C1=[C-]CC=C1.Cl.[Zr] |
| InChI | InChI=1S/C9H13.ClH.Zr/c1-9(2,3)8-6-4-5-7-8;;/h4,6H,5H2,1-3H3;1H;/q-1;; |
| InChIKey | XEEYGSBFOMGFQD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.89 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|