C14H18Fe — CID 18764321
2-tert-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) (PubChem CID 18764321) has the molecular formula C14H18Fe and a molecular weight of 242.14 g/mol. Its IUPAC name is 2-tert-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+).
| Compound Name | 2-tert-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 18764321 |
| Molecular Formula | C14H18Fe |
| Molecular Weight | 242.14 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-tert-butylcyclopenta-1,3-diene;cyclopenta-1,3-diene;iron(2+) |
| SMILES | CC(C)(C)C1=[C-]CC=C1.[C-]1=CC=CC1.[Fe+2] |
| InChI | InChI=1S/C9H13.C5H5.Fe/c1-9(2,3)8-6-4-5-7-8;1-2-4-5-3-1;/h4,6H,5H2,1-3H3;1-3H,4H2;/q2*-1;+2 |
| InChIKey | SUFFNYCYOMQKRJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.14 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|