C10H9FeI — CID 91885277
cyclopenta-1,3-diene;2-iodocyclopenta-1,3-diene;iron(2+) (PubChem CID 91885277) has the molecular formula C10H9FeI and a molecular weight of 311.93 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2-iodocyclopenta-1,3-diene;iron(2+).
| Compound Name | cyclopenta-1,3-diene;2-iodocyclopenta-1,3-diene;iron(2+) |
|---|---|
| PubChem CID | 91885277 |
| Molecular Formula | C10H9FeI |
| Molecular Weight | 311.93 g/mol |
| Exact Mass | 311.91 |
| IUPAC Name | cyclopenta-1,3-diene;2-iodocyclopenta-1,3-diene;iron(2+) |
| SMILES | IC1=[C-]CC=C1.[C-]1=CC=CC1.[Fe+2] |
| InChI | InChI=1S/C5H4I.C5H5.Fe/c6-5-3-1-2-4-5;1-2-4-5-3-1;/h1,3H,2H2;1-3H,4H2;/q2*-1;+2 |
| InChIKey | MPUKSIYKIZHHSN-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.93 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|