About λ2-stannane;(2-methyl-2-phenylpropyl) 5-bromofuran-2-carboxylate
λ2-stannane;(2-methyl-2-phenylpropyl) 5-bromofuran-2-carboxylate (PubChem CID 175022019) has the molecular formula C15H17BrO3Sn
and a molecular weight of 443.91 g/mol. Its IUPAC name is λ2-stannane;(2-methyl-2-phenylpropyl) 5-bromofuran-2-carboxylate.
Molecular Properties
| Compound Name | λ2-stannane;(2-methyl-2-phenylpropyl) 5-bromofuran-2-carboxylate |
| PubChem CID | 175022019 |
| Molecular Formula | C15H17BrO3Sn |
| Molecular Weight | 443.91 g/mol |
| Exact Mass | 443.94 |
| IUPAC Name | λ2-stannane;(2-methyl-2-phenylpropyl) 5-bromofuran-2-carboxylate |
| SMILES | CC(C)(COC(=O)c1ccc(Br)o1)c1ccccc1.[SnH2] |
| InChI | InChI=1S/C15H15BrO3.Sn.2H/c1-15(2,11-6-4-3-5-7-11)10-18-14(17)12-8-9-13(16)19-12;;;/h3-9H,10H2,1-2H3;;; |
| InChIKey | SSAKLCACKFCGNB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.91 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze λ2-stannane;(2-methyl-2-phenylpropyl) 5-bromofuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of λ2-stannane;(2-methyl-2-phenylpropyl) 5-bromofuran-2-carboxylate?
The IUPAC name of λ2-stannane;(2-methyl-2-phenylpropyl) 5-bromofuran-2-carboxylate (CID 175022019) is λ2-stannane;(2-methyl-2-phenylpropyl) 5-bromofuran-2-carboxylate.
What is the SMILES notation for λ2-stannane;(2-methyl-2-phenylpropyl) 5-bromofuran-2-carboxylate?
The canonical SMILES for λ2-stannane;(2-methyl-2-phenylpropyl) 5-bromofuran-2-carboxylate is CC(C)(COC(=O)c1ccc(Br)o1)c1ccccc1.[SnH2].
What is the InChIKey of λ2-stannane;(2-methyl-2-phenylpropyl) 5-bromofuran-2-carboxylate?
The InChIKey is SSAKLCACKFCGNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15BrO3.Sn.2H/c1-15(2,11-6-4-3-5-7-11)10-18-14(17)12-8-9-13(16)19-12;;;/h3-9H,10H2,1-2H3;;;.
What are the key properties of λ2-stannane;(2-methyl-2-phenylpropyl) 5-bromofuran-2-carboxylate?
λ2-stannane;(2-methyl-2-phenylpropyl) 5-bromofuran-2-carboxylate has a molecular weight of 443.91 g/mol, XLogP of 3.26, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for λ2-stannane;(2-methyl-2-phenylpropyl) 5-bromofuran-2-carboxylate is sourced from PubChem (CID 175022019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).