C28H26ClN2O5S- — CID 175022536
1-[[(2S)-1-carboxypropan-2-yl]-[(2-chlorophenyl)methyl]amino]-4-(4-methoxy-N-sulfinatoanilino)naphthalene (PubChem CID 175022536) has the molecular formula C28H26ClN2O5S- and a molecular weight of 538.05 g/mol. Its IUPAC name is 1-[[(2S)-1-carboxypropan-2-yl]-[(2-chlorophenyl)methyl]amino]-4-(4-methoxy-N-sulfinatoanilino)naphthalene.
| Compound Name | 1-[[(2S)-1-carboxypropan-2-yl]-[(2-chlorophenyl)methyl]amino]-4-(4-methoxy-N-sulfinatoanilino)naphthalene |
|---|---|
| PubChem CID | 175022536 |
| Molecular Formula | C28H26ClN2O5S- |
| Molecular Weight | 538.05 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | 1-[[(2S)-1-carboxypropan-2-yl]-[(2-chlorophenyl)methyl]amino]-4-(4-methoxy-N-sulfinatoanilino)naphthalene |
| SMILES | COc1ccc(N(c2ccc(N(Cc3ccccc3Cl)[C@@H](C)CC(=O)O)c3ccccc23)S(=O)[O-])cc1 |
| InChI | InChI=1S/C28H27ClN2O5S/c1-19(17-28(32)33)30(18-20-7-3-6-10-25(20)29)26-15-16-27(24-9-5-4-8-23(24)26)31(37(34)35)21-11-13-22(36-2)14-12-21/h3-16,19H,17-18H2,1-2H3,(H,32,33)(H,34,35)/p-1/t19-/m0/s1 |
| InChIKey | BYUOLYZSKPLZEE-IBGZPJMESA-M |
| XLogP | 6.30 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.05 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|