About calcium amino sulfate
calcium amino sulfate (PubChem CID 175022802) has the molecular formula H4CaN2O8S2
and a molecular weight of 264.25 g/mol. Its IUPAC name is calcium amino sulfate.
Molecular Properties
| Compound Name | calcium amino sulfate |
| PubChem CID | 175022802 |
| Molecular Formula | H4CaN2O8S2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 263.90 |
| IUPAC Name | calcium amino sulfate |
| SMILES | NOS(=O)(=O)[O-].NOS(=O)(=O)[O-].[Ca+2] |
| InChI | InChI=1S/Ca.2H3NO4S/c;2*1-5-6(2,3)4/h;2*1H2,(H,2,3,4)/q+2;;/p-2 |
| InChIKey | QCONHLXECWMCJE-UHFFFAOYSA-L |
| XLogP | -3.71 |
| TPSA | 184.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | -3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze calcium amino sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium amino sulfate?
The IUPAC name of calcium amino sulfate (CID 175022802) is calcium amino sulfate.
What is the SMILES notation for calcium amino sulfate?
The canonical SMILES for calcium amino sulfate is NOS(=O)(=O)[O-].NOS(=O)(=O)[O-].[Ca+2].
What is the InChIKey of calcium amino sulfate?
The InChIKey is QCONHLXECWMCJE-UHFFFAOYSA-L. The full InChI is InChI=1S/Ca.2H3NO4S/c;2*1-5-6(2,3)4/h;2*1H2,(H,2,3,4)/q+2;;/p-2.
What are the key properties of calcium amino sulfate?
calcium amino sulfate has a molecular weight of 264.25 g/mol, XLogP of -3.71, 2 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for calcium amino sulfate is sourced from PubChem (CID 175022802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).