C25H26N2O6 — CID 175023263
3-hydroxy-2-[[4-[(2-methyl-3-phenylphenyl)methoxy]-3-nitrophenyl]methylamino]butanoic acid (PubChem CID 175023263) has the molecular formula C25H26N2O6 and a molecular weight of 450.49 g/mol. Its IUPAC name is 3-hydroxy-2-[[4-[(2-methyl-3-phenylphenyl)methoxy]-3-nitrophenyl]methylamino]butanoic acid.
| Compound Name | 3-hydroxy-2-[[4-[(2-methyl-3-phenylphenyl)methoxy]-3-nitrophenyl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 175023263 |
| Molecular Formula | C25H26N2O6 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 3-hydroxy-2-[[4-[(2-methyl-3-phenylphenyl)methoxy]-3-nitrophenyl]methylamino]butanoic acid |
| SMILES | Cc1c(COc2ccc(CNC(C(=O)O)C(C)O)cc2[N+](=O)[O-])cccc1-c1ccccc1 |
| InChI | InChI=1S/C25H26N2O6/c1-16-20(9-6-10-21(16)19-7-4-3-5-8-19)15-33-23-12-11-18(13-22(23)27(31)32)14-26-24(17(2)28)25(29)30/h3-13,17,24,26,28H,14-15H2,1-2H3,(H,29,30) |
| InChIKey | MWEDFEMCCVQHQI-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 121.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|