C26H28N2O6 — CID 175019510
methyl 3-hydroxy-2-[[4-[(2-methyl-3-phenylphenyl)methoxy]-3-nitrophenyl]methylamino]butanoate (PubChem CID 175019510) has the molecular formula C26H28N2O6 and a molecular weight of 464.52 g/mol. Its IUPAC name is methyl 3-hydroxy-2-[[4-[(2-methyl-3-phenylphenyl)methoxy]-3-nitrophenyl]methylamino]butanoate.
| Compound Name | methyl 3-hydroxy-2-[[4-[(2-methyl-3-phenylphenyl)methoxy]-3-nitrophenyl]methylamino]butanoate |
|---|---|
| PubChem CID | 175019510 |
| Molecular Formula | C26H28N2O6 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | methyl 3-hydroxy-2-[[4-[(2-methyl-3-phenylphenyl)methoxy]-3-nitrophenyl]methylamino]butanoate |
| SMILES | COC(=O)C(NCc1ccc(OCc2cccc(-c3ccccc3)c2C)c([N+](=O)[O-])c1)C(C)O |
| InChI | InChI=1S/C26H28N2O6/c1-17-21(10-7-11-22(17)20-8-5-4-6-9-20)16-34-24-13-12-19(14-23(24)28(31)32)15-27-25(18(2)29)26(30)33-3/h4-14,18,25,27,29H,15-16H2,1-3H3 |
| InChIKey | UTYYKHLSDPGMRL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 110.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|